C15H25BrN2O2S — CID 8716846
3-bromo-N-[(2S)-5-(diethylamino)pentan-2-yl]benzenesulfonamide (PubChem CID 8716846) has the molecular formula C15H25BrN2O2S and a molecular weight of 377.35 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-5-(diethylamino)pentan-2-yl]benzenesulfonamide.
| Compound Name | 3-bromo-N-[(2S)-5-(diethylamino)pentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 8716846 |
| Molecular Formula | C15H25BrN2O2S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-bromo-N-[(2S)-5-(diethylamino)pentan-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)CCC[C@H](C)NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H25BrN2O2S/c1-4-18(5-2)11-7-8-13(3)17-21(19,20)15-10-6-9-14(16)12-15/h6,9-10,12-13,17H,4-5,7-8,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | RRDGFHFUXHQBNW-ZDUSSCGKSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |