C21H30N2O2S — CID 3679423
N-[5-(diethylamino)pentan-2-yl]-4-phenylbenzenesulfonamide (PubChem CID 3679423) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 3679423 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-4-phenylbenzenesulfonamide |
| SMILES | CCN(CC)CCCC(C)NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H30N2O2S/c1-4-23(5-2)17-9-10-18(3)22-26(24,25)21-15-13-20(14-16-21)19-11-7-6-8-12-19/h6-8,11-16,18,22H,4-5,9-10,17H2,1-3H3 |
| InChIKey | SADVIZRXDNNKFZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |