C16H25N3O2S — CID 8000367
4-cyano-N-[(2R)-5-(diethylamino)pentan-2-yl]benzenesulfonamide (PubChem CID 8000367) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-cyano-N-[(2R)-5-(diethylamino)pentan-2-yl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(2R)-5-(diethylamino)pentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 8000367 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-cyano-N-[(2R)-5-(diethylamino)pentan-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)CCC[C@@H](C)NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-4-19(5-2)12-6-7-14(3)18-22(20,21)16-10-8-15(13-17)9-11-16/h8-11,14,18H,4-7,12H2,1-3H3/t14-/m1/s1 |
| InChIKey | KYVFHJDRNVCFSM-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |