C16H25ClN2O4S — CID 100820173
2-chloro-5-[[(2S)-5-(diethylamino)pentan-2-yl]sulfamoyl]benzoic acid (PubChem CID 100820173) has the molecular formula C16H25ClN2O4S and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-chloro-5-[[(2S)-5-(diethylamino)pentan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[[(2S)-5-(diethylamino)pentan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 100820173 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-chloro-5-[[(2S)-5-(diethylamino)pentan-2-yl]sulfamoyl]benzoic acid |
| SMILES | CCN(CC)CCC[C@H](C)NS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H25ClN2O4S/c1-4-19(5-2)10-6-7-12(3)18-24(22,23)13-8-9-15(17)14(11-13)16(20)21/h8-9,11-12,18H,4-7,10H2,1-3H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | RXQONHONQQCPGU-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |