C13H16ClNO6S — CID 5120365
5-[(1-carboxy-2-methylbutyl)sulfamoyl]-2-chlorobenzoic acid (PubChem CID 5120365) has the molecular formula C13H16ClNO6S and a molecular weight of 349.79 g/mol. Its IUPAC name is 5-[(1-carboxy-2-methylbutyl)sulfamoyl]-2-chlorobenzoic acid.
| Compound Name | 5-[(1-carboxy-2-methylbutyl)sulfamoyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 5120365 |
| Molecular Formula | C13H16ClNO6S |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 5-[(1-carboxy-2-methylbutyl)sulfamoyl]-2-chlorobenzoic acid |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C13H16ClNO6S/c1-3-7(2)11(13(18)19)15-22(20,21)8-4-5-10(14)9(6-8)12(16)17/h4-7,11,15H,3H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | CNKFCEUBFWDWJK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |