C12H16ClNO4S — CID 43084241
2-[(3-chlorophenyl)sulfonylamino]-3-methylpentanoic acid (PubChem CID 43084241) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfonylamino]-3-methylpentanoic acid.
| Compound Name | 2-[(3-chlorophenyl)sulfonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 43084241 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfonylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NS(=O)(=O)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H16ClNO4S/c1-3-8(2)11(12(15)16)14-19(17,18)10-6-4-5-9(13)7-10/h4-8,11,14H,3H2,1-2H3,(H,15,16) |
| InChIKey | MKIYFNFFDWSRGI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |