C18H21ClN2O4S — CID 122178462
(2S,3S)-2-[[3-(4-chlorophenyl)phenyl]sulfonylamino]-N-hydroxy-3-methylpentanamide (PubChem CID 122178462) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is (2S,3S)-2-[[3-(4-chlorophenyl)phenyl]sulfonylamino]-N-hydroxy-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[3-(4-chlorophenyl)phenyl]sulfonylamino]-N-hydroxy-3-methylpentanamide |
|---|---|
| PubChem CID | 122178462 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (2S,3S)-2-[[3-(4-chlorophenyl)phenyl]sulfonylamino]-N-hydroxy-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)c1cccc(-c2ccc(Cl)cc2)c1)C(=O)NO |
| InChI | InChI=1S/C18H21ClN2O4S/c1-3-12(2)17(18(22)20-23)21-26(24,25)16-6-4-5-14(11-16)13-7-9-15(19)10-8-13/h4-12,17,21,23H,3H2,1-2H3,(H,20,22)/t12-,17-/m0/s1 |
| InChIKey | NDLSXKFXYYCFEY-SJCJKPOMSA-N |
| XLogP | 3.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|