C11H14Cl2N2O4S — CID 134100923
2-[(3,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 134100923) has the molecular formula C11H14Cl2N2O4S and a molecular weight of 341.22 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 134100923 |
| Molecular Formula | C11H14Cl2N2O4S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1cc(Cl)cc(Cl)c1)C(=O)NO |
| InChI | InChI=1S/C11H14Cl2N2O4S/c1-6(2)10(11(16)14-17)15-20(18,19)9-4-7(12)3-8(13)5-9/h3-6,10,15,17H,1-2H3,(H,14,16) |
| InChIKey | JYJXTXNSMZWNGB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|