C18H24N2O4S — CID 54284298
(2S)-N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydro-5H-fluoren-2-ylsulfonylamino)butanamide (PubChem CID 54284298) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S)-N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydro-5H-fluoren-2-ylsulfonylamino)butanamide.
| Compound Name | (2S)-N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydro-5H-fluoren-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 54284298 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2S)-N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydro-5H-fluoren-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)CC1=C2CCCC1)C(=O)NO |
| InChI | InChI=1S/C18H24N2O4S/c1-11(2)17(18(21)19-22)20-25(23,24)14-7-8-16-13(10-14)9-12-5-3-4-6-15(12)16/h7-8,10-11,17,20,22H,3-6,9H2,1-2H3,(H,19,21)/t17-/m0/s1 |
| InChIKey | RSZXSYOEVCQTMZ-KRWDZBQOSA-N |
| XLogP | 2.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|