C17H22N2O4S2 — CID 18386316
N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydrodibenzothiophen-3-ylsulfonylamino)butanamide (PubChem CID 18386316) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydrodibenzothiophen-3-ylsulfonylamino)butanamide.
| Compound Name | N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydrodibenzothiophen-3-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 18386316 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-hydroxy-3-methyl-2-(6,7,8,9-tetrahydrodibenzothiophen-3-ylsulfonylamino)butanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc2c3c(sc2c1)CCCC3)C(=O)NO |
| InChI | InChI=1S/C17H22N2O4S2/c1-10(2)16(17(20)18-21)19-25(22,23)11-7-8-13-12-5-3-4-6-14(12)24-15(13)9-11/h7-10,16,19,21H,3-6H2,1-2H3,(H,18,20) |
| InChIKey | BZQWQTZPEKNVFG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|