C12H13NO2S2 — CID 141017575
6,7,8,9-tetrahydrodibenzothiophene-3-sulfonamide (PubChem CID 141017575) has the molecular formula C12H13NO2S2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrodibenzothiophene-3-sulfonamide.
| Compound Name | 6,7,8,9-tetrahydrodibenzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 141017575 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 6,7,8,9-tetrahydrodibenzothiophene-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c3c(sc2c1)CCCC3 |
| InChI | InChI=1S/C12H13NO2S2/c13-17(14,15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h5-7H,1-4H2,(H2,13,14,15) |
| InChIKey | NDGCYPYIZGXHJC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |