C12H11ClS — CID 54320978
8-chloro-1,2,3,4-tetrahydrodibenzothiophene (PubChem CID 54320978) has the molecular formula C12H11ClS and a molecular weight of 222.74 g/mol. Its IUPAC name is 8-chloro-1,2,3,4-tetrahydrodibenzothiophene.
| Compound Name | 8-chloro-1,2,3,4-tetrahydrodibenzothiophene |
|---|---|
| PubChem CID | 54320978 |
| Molecular Formula | C12H11ClS |
| Molecular Weight | 222.74 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 8-chloro-1,2,3,4-tetrahydrodibenzothiophene |
| SMILES | Clc1ccc2sc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C12H11ClS/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h5-7H,1-4H2 |
| InChIKey | SRQFCYVFEMVUJT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |