C11H9ClOS — CID 86172878
6-chloro-2,3-dimethylthiochromen-4-one (PubChem CID 86172878) has the molecular formula C11H9ClOS and a molecular weight of 224.71 g/mol. Its IUPAC name is 6-chloro-2,3-dimethylthiochromen-4-one.
| Compound Name | 6-chloro-2,3-dimethylthiochromen-4-one |
|---|---|
| PubChem CID | 86172878 |
| Molecular Formula | C11H9ClOS |
| Molecular Weight | 224.71 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 6-chloro-2,3-dimethylthiochromen-4-one |
| SMILES | Cc1sc2ccc(Cl)cc2c(=O)c1C |
| InChI | InChI=1S/C11H9ClOS/c1-6-7(2)14-10-4-3-8(12)5-9(10)11(6)13/h3-5H,1-2H3 |
| InChIKey | SICDOWQBMKCIBX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |