C9H8ClNO2S2 — CID 150846661
5-chloro-2-methyl-1-benzothiophene-3-sulfonamide (PubChem CID 150846661) has the molecular formula C9H8ClNO2S2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 5-chloro-2-methyl-1-benzothiophene-3-sulfonamide.
| Compound Name | 5-chloro-2-methyl-1-benzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 150846661 |
| Molecular Formula | C9H8ClNO2S2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 5-chloro-2-methyl-1-benzothiophene-3-sulfonamide |
| SMILES | Cc1sc2ccc(Cl)cc2c1S(N)(=O)=O |
| InChI | InChI=1S/C9H8ClNO2S2/c1-5-9(15(11,12)13)7-4-6(10)2-3-8(7)14-5/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | KPDMSYOTCBAQLK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |