C16H16ClNO4S2 — CID 166377783
1-[[(5-chloro-2-methyl-1-benzothiophen-3-yl)sulfonylamino]methyl]cyclopent-3-ene-1-carboxylic acid (PubChem CID 166377783) has the molecular formula C16H16ClNO4S2 and a molecular weight of 385.89 g/mol. Its IUPAC name is 1-[[(5-chloro-2-methyl-1-benzothiophen-3-yl)sulfonylamino]methyl]cyclopent-3-ene-1-carboxylic acid.
| Compound Name | 1-[[(5-chloro-2-methyl-1-benzothiophen-3-yl)sulfonylamino]methyl]cyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166377783 |
| Molecular Formula | C16H16ClNO4S2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 1-[[(5-chloro-2-methyl-1-benzothiophen-3-yl)sulfonylamino]methyl]cyclopent-3-ene-1-carboxylic acid |
| SMILES | Cc1sc2ccc(Cl)cc2c1S(=O)(=O)NCC1(C(=O)O)CC=CC1 |
| InChI | InChI=1S/C16H16ClNO4S2/c1-10-14(12-8-11(17)4-5-13(12)23-10)24(21,22)18-9-16(15(19)20)6-2-3-7-16/h2-5,8,18H,6-7,9H2,1H3,(H,19,20) |
| InChIKey | FGWVQRZZOGMBBK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|