C15H17ClN2O2S2 — CID 120721657
5-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1-benzothiophene-3-sulfonamide (PubChem CID 120721657) has the molecular formula C15H17ClN2O2S2 and a molecular weight of 356.90 g/mol. Its IUPAC name is 5-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1-benzothiophene-3-sulfonamide.
| Compound Name | 5-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1-benzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 120721657 |
| Molecular Formula | C15H17ClN2O2S2 |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 5-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1-benzothiophene-3-sulfonamide |
| SMILES | Cc1sc2ccc(Cl)cc2c1S(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C15H17ClN2O2S2/c1-10-15(13-8-12(16)2-3-14(13)21-10)22(19,20)18-9-11-4-6-17-7-5-11/h2-4,8,17-18H,5-7,9H2,1H3 |
| InChIKey | FAIOSGWWUHJYNL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|