C12H15Cl3N2O2S — CID 120721562
3,4-dichloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 120721562) has the molecular formula C12H15Cl3N2O2S and a molecular weight of 357.69 g/mol. Its IUPAC name is 3,4-dichloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 3,4-dichloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721562 |
| Molecular Formula | C12H15Cl3N2O2S |
| Molecular Weight | 357.69 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 3,4-dichloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCC1=CCNCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O2S.ClH/c13-11-2-1-10(7-12(11)14)19(17,18)16-8-9-3-5-15-6-4-9;/h1-3,7,15-16H,4-6,8H2;1H |
| InChIKey | ISIQQVREGHUNMM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|