C13H15Cl2F3N2O2S — CID 120721746
2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 120721746) has the molecular formula C13H15Cl2F3N2O2S and a molecular weight of 391.24 g/mol. Its IUPAC name is 2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721746 |
| Molecular Formula | C13H15Cl2F3N2O2S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCC1=CCNCC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C13H14ClF3N2O2S.ClH/c14-11-2-1-10(13(15,16)17)7-12(11)22(20,21)19-8-9-3-5-18-6-4-9;/h1-3,7,18-19H,4-6,8H2;1H |
| InChIKey | JQJJYSHNMBOLSB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|