C13H15F3N2O2S — CID 114694184
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 114694184) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114694184 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1=CCNCC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O2S/c14-13(15,16)11-3-1-2-4-12(11)21(19,20)18-9-10-5-7-17-8-6-10/h1-5,17-18H,6-9H2 |
| InChIKey | XGNBOLKPPINMHI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|