C12H15IN2O2S — CID 120721119
3-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide (PubChem CID 120721119) has the molecular formula C12H15IN2O2S and a molecular weight of 378.24 g/mol. Its IUPAC name is 3-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide.
| Compound Name | 3-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120721119 |
| Molecular Formula | C12H15IN2O2S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 3-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1=CCNCC1)c1cccc(I)c1 |
| InChI | InChI=1S/C12H15IN2O2S/c13-11-2-1-3-12(8-11)18(16,17)15-9-10-4-6-14-7-5-10/h1-4,8,14-15H,5-7,9H2 |
| InChIKey | LWDGTKSZSJLDMB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|