C21H9Cl3OS — CID 59502532
2,9,10-trichloronaphtho[2,3-b]thioxanthen-14-one (PubChem CID 59502532) has the molecular formula C21H9Cl3OS and a molecular weight of 415.73 g/mol. Its IUPAC name is 2,9,10-trichloronaphtho[2,3-b]thioxanthen-14-one.
| Compound Name | 2,9,10-trichloronaphtho[2,3-b]thioxanthen-14-one |
|---|---|
| PubChem CID | 59502532 |
| Molecular Formula | C21H9Cl3OS |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2,9,10-trichloronaphtho[2,3-b]thioxanthen-14-one |
| SMILES | O=c1c2cc(Cl)ccc2sc2cc3cc4cc(Cl)c(Cl)cc4cc3cc12 |
| InChI | InChI=1S/C21H9Cl3OS/c22-14-1-2-19-16(9-14)21(25)15-5-10-3-11-6-17(23)18(24)7-12(11)4-13(10)8-20(15)26-19/h1-9H |
| InChIKey | ATFSFWFCXNUJEB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|