About 2-chlorothioxanthen-9-one;9,10-dimethylanthracene
2-chlorothioxanthen-9-one;9,10-dimethylanthracene (PubChem CID 158085285) has the molecular formula C29H21ClOS
and a molecular weight of 453.01 g/mol. Its IUPAC name is 2-chlorothioxanthen-9-one;9,10-dimethylanthracene.
Molecular Properties
| Compound Name | 2-chlorothioxanthen-9-one;9,10-dimethylanthracene |
| PubChem CID | 158085285 |
| Molecular Formula | C29H21ClOS |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-chlorothioxanthen-9-one;9,10-dimethylanthracene |
| SMILES | Cc1c2ccccc2c(C)c2ccccc12.O=c1c2ccccc2sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H14.C13H7ClOS/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16;14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h3-10H,1-2H3;1-7H |
| InChIKey | FNLAEFJTVNWTOY-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorothioxanthen-9-one;9,10-dimethylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorothioxanthen-9-one;9,10-dimethylanthracene?
The IUPAC name of 2-chlorothioxanthen-9-one;9,10-dimethylanthracene (CID 158085285) is 2-chlorothioxanthen-9-one;9,10-dimethylanthracene.
What is the SMILES notation for 2-chlorothioxanthen-9-one;9,10-dimethylanthracene?
The canonical SMILES for 2-chlorothioxanthen-9-one;9,10-dimethylanthracene is Cc1c2ccccc2c(C)c2ccccc12.O=c1c2ccccc2sc2ccc(Cl)cc12.
What is the InChIKey of 2-chlorothioxanthen-9-one;9,10-dimethylanthracene?
The InChIKey is FNLAEFJTVNWTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14.C13H7ClOS/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16;14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h3-10H,1-2H3;1-7H.
What are the key properties of 2-chlorothioxanthen-9-one;9,10-dimethylanthracene?
2-chlorothioxanthen-9-one;9,10-dimethylanthracene has a molecular weight of 453.01 g/mol, XLogP of 8.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorothioxanthen-9-one;9,10-dimethylanthracene is sourced from PubChem (CID 158085285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).