C13H17N3O4S3 — CID 10199496
(2R)-N-hydroxy-3-methyl-2-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]butanamide (PubChem CID 10199496) has the molecular formula C13H17N3O4S3 and a molecular weight of 375.50 g/mol. Its IUPAC name is (2R)-N-hydroxy-3-methyl-2-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]butanamide.
| Compound Name | (2R)-N-hydroxy-3-methyl-2-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 10199496 |
| Molecular Formula | C13H17N3O4S3 |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | (2R)-N-hydroxy-3-methyl-2-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]butanamide |
| SMILES | CSc1nc2ccc(S(=O)(=O)N[C@@H](C(=O)NO)C(C)C)cc2s1 |
| InChI | InChI=1S/C13H17N3O4S3/c1-7(2)11(12(17)15-18)16-23(19,20)8-4-5-9-10(6-8)22-13(14-9)21-3/h4-7,11,16,18H,1-3H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | OMQLNMRUOLXWQL-LLVKDONJSA-N |
| XLogP | 1.83 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|