C18H27N3O4S4 — CID 87887951
(2R)-2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-4-methylsulfanylbutanamide (PubChem CID 87887951) has the molecular formula C18H27N3O4S4 and a molecular weight of 477.70 g/mol. Its IUPAC name is (2R)-2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 87887951 |
| Molecular Formula | C18H27N3O4S4 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (2R)-2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-4-methylsulfanylbutanamide |
| SMILES | CCCCCCSc1nc2ccc(S(=O)(=O)N[C@H](CCSC)C(=O)NO)cc2s1 |
| InChI | InChI=1S/C18H27N3O4S4/c1-3-4-5-6-10-27-18-19-14-8-7-13(12-16(14)28-18)29(24,25)21-15(9-11-26-2)17(22)20-23/h7-8,12,15,21,23H,3-6,9-11H2,1-2H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | QDYYCYGMQJJXNP-OAHLLOKOSA-N |
| XLogP | 3.87 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|