C23H28N2O4S3 — CID 90746157
methyl (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]propanoate (PubChem CID 90746157) has the molecular formula C23H28N2O4S3 and a molecular weight of 492.69 g/mol. Its IUPAC name is methyl (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]propanoate |
|---|---|
| PubChem CID | 90746157 |
| Molecular Formula | C23H28N2O4S3 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | methyl (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]propanoate |
| SMILES | CCCCCSc1nc2ccc(S(=O)(=O)N(Cc3ccccc3)[C@H](C)C(=O)OC)cc2s1 |
| InChI | InChI=1S/C23H28N2O4S3/c1-4-5-9-14-30-23-24-20-13-12-19(15-21(20)31-23)32(27,28)25(17(2)22(26)29-3)16-18-10-7-6-8-11-18/h6-8,10-13,15,17H,4-5,9,14,16H2,1-3H3/t17-/m1/s1 |
| InChIKey | GTOGTOMYQSSYCX-QGZVFWFLSA-N |
| XLogP | 5.33 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|