C20H24N2O2S3 — CID 141031818
N-benzyl-2-hexylsulfanyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 141031818) has the molecular formula C20H24N2O2S3 and a molecular weight of 420.63 g/mol. Its IUPAC name is N-benzyl-2-hexylsulfanyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-benzyl-2-hexylsulfanyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 141031818 |
| Molecular Formula | C20H24N2O2S3 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-benzyl-2-hexylsulfanyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCCCCCSc1nc2ccc(S(=O)(=O)NCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C20H24N2O2S3/c1-2-3-4-8-13-25-20-22-18-12-11-17(14-19(18)26-20)27(23,24)21-15-16-9-6-5-7-10-16/h5-7,9-12,14,21H,2-4,8,13,15H2,1H3 |
| InChIKey | GODAIQSNYRAEQF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|