C14H20N2O2S3 — CID 142682349
2-ethylsulfanyl-N-(3-methylbutyl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 142682349) has the molecular formula C14H20N2O2S3 and a molecular weight of 344.53 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-(3-methylbutyl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-ethylsulfanyl-N-(3-methylbutyl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 142682349 |
| Molecular Formula | C14H20N2O2S3 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-ethylsulfanyl-N-(3-methylbutyl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCSc1nc2ccc(S(=O)(=O)NCCC(C)C)cc2s1 |
| InChI | InChI=1S/C14H20N2O2S3/c1-4-19-14-16-12-6-5-11(9-13(12)20-14)21(17,18)15-8-7-10(2)3/h5-6,9-10,15H,4,7-8H2,1-3H3 |
| InChIKey | OCZUEAHIIYYEMV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |