C15H20N2O2S3 — CID 142682357
N-cyclohexyl-2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 142682357) has the molecular formula C15H20N2O2S3 and a molecular weight of 356.54 g/mol. Its IUPAC name is N-cyclohexyl-2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-cyclohexyl-2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 142682357 |
| Molecular Formula | C15H20N2O2S3 |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-cyclohexyl-2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCSc1nc2ccc(S(=O)(=O)NC3CCCCC3)cc2s1 |
| InChI | InChI=1S/C15H20N2O2S3/c1-2-20-15-16-13-9-8-12(10-14(13)21-15)22(18,19)17-11-6-4-3-5-7-11/h8-11,17H,2-7H2,1H3 |
| InChIKey | CZYCLNMGEUATGC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |