C13H18N2O3S — CID 46374849
2-methyl-N-(3-methylbutyl)-1,3-benzoxazole-6-sulfonamide (PubChem CID 46374849) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-methyl-N-(3-methylbutyl)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-methyl-N-(3-methylbutyl)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 46374849 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-methyl-N-(3-methylbutyl)-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cc1nc2ccc(S(=O)(=O)NCCC(C)C)cc2o1 |
| InChI | InChI=1S/C13H18N2O3S/c1-9(2)6-7-14-19(16,17)11-4-5-12-13(8-11)18-10(3)15-12/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChIKey | OKAGUEURHZLECY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |