C11H13NO4S — CID 116853227
3-[(2-methyl-1,3-benzoxazol-6-yl)sulfonyl]propan-1-ol (PubChem CID 116853227) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-benzoxazol-6-yl)sulfonyl]propan-1-ol.
| Compound Name | 3-[(2-methyl-1,3-benzoxazol-6-yl)sulfonyl]propan-1-ol |
|---|---|
| PubChem CID | 116853227 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-[(2-methyl-1,3-benzoxazol-6-yl)sulfonyl]propan-1-ol |
| SMILES | Cc1nc2ccc(S(=O)(=O)CCCO)cc2o1 |
| InChI | InChI=1S/C11H13NO4S/c1-8-12-10-4-3-9(7-11(10)16-8)17(14,15)6-2-5-13/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | ZLDJBMGSFLBWEY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |