C9H10N2O2 — CID 115228727
[(2-methyl-1,3-benzoxazol-6-yl)amino]methanol (PubChem CID 115228727) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is [(2-methyl-1,3-benzoxazol-6-yl)amino]methanol.
| Compound Name | [(2-methyl-1,3-benzoxazol-6-yl)amino]methanol |
|---|---|
| PubChem CID | 115228727 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | [(2-methyl-1,3-benzoxazol-6-yl)amino]methanol |
| SMILES | Cc1nc2ccc(NCO)cc2o1 |
| InChI | InChI=1S/C9H10N2O2/c1-6-11-8-3-2-7(10-5-12)4-9(8)13-6/h2-4,10,12H,5H2,1H3 |
| InChIKey | KJOHDBCRHGPCQC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|