C9H12N4O — CID 115260505
N-(hydrazinylmethyl)-2-methyl-1,3-benzoxazol-6-amine (PubChem CID 115260505) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(hydrazinylmethyl)-2-methyl-1,3-benzoxazol-6-amine.
| Compound Name | N-(hydrazinylmethyl)-2-methyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115260505 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-(hydrazinylmethyl)-2-methyl-1,3-benzoxazol-6-amine |
| SMILES | Cc1nc2ccc(NCNN)cc2o1 |
| InChI | InChI=1S/C9H12N4O/c1-6-13-8-3-2-7(11-5-12-10)4-9(8)14-6/h2-4,11-12H,5,10H2,1H3 |
| InChIKey | ISKLKOSEKVMQMB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|