C11H12N2O — CID 83483514
N-cyclopropyl-2-methyl-1,3-benzoxazol-6-amine (PubChem CID 83483514) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-1,3-benzoxazol-6-amine.
| Compound Name | N-cyclopropyl-2-methyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 83483514 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-cyclopropyl-2-methyl-1,3-benzoxazol-6-amine |
| SMILES | Cc1nc2ccc(NC3CC3)cc2o1 |
| InChI | InChI=1S/C11H12N2O/c1-7-12-10-5-4-9(6-11(10)14-7)13-8-2-3-8/h4-6,8,13H,2-3H2,1H3 |
| InChIKey | XHLRSZFVERCKSJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |