C14H18N2O — CID 96672948
N-[3-(2-methyl-1,3-benzoxazol-6-yl)propyl]cyclopropanamine (PubChem CID 96672948) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-benzoxazol-6-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(2-methyl-1,3-benzoxazol-6-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 96672948 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-[3-(2-methyl-1,3-benzoxazol-6-yl)propyl]cyclopropanamine |
| SMILES | Cc1nc2ccc(CCCNC3CC3)cc2o1 |
| InChI | InChI=1S/C14H18N2O/c1-10-16-13-7-4-11(9-14(13)17-10)3-2-8-15-12-5-6-12/h4,7,9,12,15H,2-3,5-6,8H2,1H3 |
| InChIKey | YQDBQHABZJBSIW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|