C16H22N2O — CID 64732967
N-(3,4-dimethylcyclohexyl)-2-methyl-1,3-benzoxazol-5-amine (PubChem CID 64732967) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-2-methyl-1,3-benzoxazol-5-amine.
| Compound Name | N-(3,4-dimethylcyclohexyl)-2-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 64732967 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-2-methyl-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2cc(NC3CCC(C)C(C)C3)ccc2o1 |
| InChI | InChI=1S/C16H22N2O/c1-10-4-5-13(8-11(10)2)18-14-6-7-16-15(9-14)17-12(3)19-16/h6-7,9-11,13,18H,4-5,8H2,1-3H3 |
| InChIKey | VRQZCDFEGQPTEL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |