C13H16N2O — CID 28675875
N-cyclopentyl-2-methyl-1,3-benzoxazol-5-amine (PubChem CID 28675875) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-1,3-benzoxazol-5-amine.
| Compound Name | N-cyclopentyl-2-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 28675875 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-cyclopentyl-2-methyl-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2cc(NC3CCCC3)ccc2o1 |
| InChI | InChI=1S/C13H16N2O/c1-9-14-12-8-11(6-7-13(12)16-9)15-10-4-2-3-5-10/h6-8,10,15H,2-5H2,1H3 |
| InChIKey | CAPVGZYWCAGQQI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |