C18H24N2O — CID 43686416
N-cyclooctyl-2-cyclopropyl-1,3-benzoxazol-5-amine (PubChem CID 43686416) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-cyclooctyl-2-cyclopropyl-1,3-benzoxazol-5-amine.
| Compound Name | N-cyclooctyl-2-cyclopropyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 43686416 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-cyclooctyl-2-cyclopropyl-1,3-benzoxazol-5-amine |
| SMILES | c1cc2oc(C3CC3)nc2cc1NC1CCCCCCC1 |
| InChI | InChI=1S/C18H24N2O/c1-2-4-6-14(7-5-3-1)19-15-10-11-17-16(12-15)20-18(21-17)13-8-9-13/h10-14,19H,1-9H2 |
| InChIKey | OHMAIVFYTYDYRC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |