C13H16N2O — CID 770201
2-cyclohexyl-1,3-benzoxazol-5-amine (PubChem CID 770201) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-benzoxazol-5-amine.
| Compound Name | 2-cyclohexyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 770201 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-cyclohexyl-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H16N2O/c14-10-6-7-12-11(8-10)15-13(16-12)9-4-2-1-3-5-9/h6-9H,1-5,14H2 |
| InChIKey | SMJKERVKAQFVLY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|