C13H11NO — CID 166973318
2-cyclobutyl-5-ethynyl-1,3-benzoxazole (PubChem CID 166973318) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-cyclobutyl-5-ethynyl-1,3-benzoxazole.
| Compound Name | 2-cyclobutyl-5-ethynyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 166973318 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-cyclobutyl-5-ethynyl-1,3-benzoxazole |
| SMILES | C#Cc1ccc2oc(C3CCC3)nc2c1 |
| InChI | InChI=1S/C13H11NO/c1-2-9-6-7-12-11(8-9)14-13(15-12)10-4-3-5-10/h1,6-8,10H,3-5H2 |
| InChIKey | FRIQOQHQHQZYAK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|