C12H8FNO — CID 166973320
2-cyclopropyl-5-ethynyl-6-fluoro-1,3-benzoxazole (PubChem CID 166973320) has the molecular formula C12H8FNO and a molecular weight of 201.20 g/mol. Its IUPAC name is 2-cyclopropyl-5-ethynyl-6-fluoro-1,3-benzoxazole.
| Compound Name | 2-cyclopropyl-5-ethynyl-6-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 166973320 |
| Molecular Formula | C12H8FNO |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-cyclopropyl-5-ethynyl-6-fluoro-1,3-benzoxazole |
| SMILES | C#Cc1cc2nc(C3CC3)oc2cc1F |
| InChI | InChI=1S/C12H8FNO/c1-2-7-5-10-11(6-9(7)13)15-12(14-10)8-3-4-8/h1,5-6,8H,3-4H2 |
| InChIKey | YQTXYEHBRPMKFA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|