About cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine
cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine (PubChem CID 106323743) has the molecular formula C12H13ClN2O
and a molecular weight of 236.70 g/mol. Its IUPAC name is cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine |
| PubChem CID | 106323743 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine |
| SMILES | N[C@H]1CC[C@@H](c2nc3ccc(Cl)cc3o2)C1 |
| InChI | InChI=1S/C12H13ClN2O/c13-8-2-4-10-11(6-8)16-12(15-10)7-1-3-9(14)5-7/h2,4,6-7,9H,1,3,5,14H2/t7-,9+/m1/s1 |
| InChIKey | AYOQCXFUIYTOFD-APPZFPTMSA-N |
| XLogP | 3.08 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine?
The IUPAC name of cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine (CID 106323743) is cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine.
What is the SMILES notation for cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine?
The canonical SMILES for cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine is N[C@H]1CC[C@@H](c2nc3ccc(Cl)cc3o2)C1.
What is the InChIKey of cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine?
The InChIKey is AYOQCXFUIYTOFD-APPZFPTMSA-N. The full InChI is InChI=1S/C12H13ClN2O/c13-8-2-4-10-11(6-8)16-12(15-10)7-1-3-9(14)5-7/h2,4,6-7,9H,1,3,5,14H2/t7-,9+/m1/s1.
What are the key properties of cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine?
cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine has a molecular weight of 236.70 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-3-(6-chloro-1,3-benzoxazol-2-yl)cyclopentan-1-amine is sourced from PubChem (CID 106323743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).