C12H13BrN2O — CID 106323731
cis-(1S,3R)-3-(5-bromo-1,3-benzoxazol-2-yl)cyclopentan-1-amine (PubChem CID 106323731) has the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. Its IUPAC name is cis-(1S,3R)-3-(5-bromo-1,3-benzoxazol-2-yl)cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-(5-bromo-1,3-benzoxazol-2-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 106323731 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | cis-(1S,3R)-3-(5-bromo-1,3-benzoxazol-2-yl)cyclopentan-1-amine |
| SMILES | N[C@H]1CC[C@@H](c2nc3cc(Br)ccc3o2)C1 |
| InChI | InChI=1S/C12H13BrN2O/c13-8-2-4-11-10(6-8)15-12(16-11)7-1-3-9(14)5-7/h2,4,6-7,9H,1,3,5,14H2/t7-,9+/m1/s1 |
| InChIKey | JDTRQIKTUAUIBI-APPZFPTMSA-N |
| XLogP | 3.19 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |