C13H12N4O — CID 117353133
4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-1H-pyrazol-5-amine (PubChem CID 117353133) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117353133 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1ccc2oc(C3CC3)nc2c1 |
| InChI | InChI=1S/C13H12N4O/c14-12-9(6-15-17-12)8-3-4-11-10(5-8)16-13(18-11)7-1-2-7/h3-7H,1-2H2,(H3,14,15,17) |
| InChIKey | ZYJBHBYJSFHWEP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |