About 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine
4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine (PubChem CID 117289185) has the molecular formula C10H8N4O
and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine |
| PubChem CID | 117289185 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1ccc2oncc2c1 |
| InChI | InChI=1S/C10H8N4O/c11-10-8(5-12-14-10)6-1-2-9-7(3-6)4-13-15-9/h1-5H,(H3,11,12,14) |
| InChIKey | CVEVREVFXOTWFP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine?
The IUPAC name of 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine (CID 117289185) is 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine?
The canonical SMILES for 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine is Nc1[nH]ncc1-c1ccc2oncc2c1.
What is the InChIKey of 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine?
The InChIKey is CVEVREVFXOTWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O/c11-10-8(5-12-14-10)6-1-2-9-7(3-6)4-13-15-9/h1-5H,(H3,11,12,14).
What are the key properties of 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine?
4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine has a molecular weight of 200.20 g/mol, XLogP of 1.80, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-benzoxazol-5-yl)-1H-pyrazol-5-amine is sourced from PubChem (CID 117289185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).