C11H10N4S — CID 117332699
4-(2-methyl-1,3-benzothiazol-6-yl)-1H-pyrazol-5-amine (PubChem CID 117332699) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-(2-methyl-1,3-benzothiazol-6-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-methyl-1,3-benzothiazol-6-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117332699 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(2-methyl-1,3-benzothiazol-6-yl)-1H-pyrazol-5-amine |
| SMILES | Cc1nc2ccc(-c3cn[nH]c3N)cc2s1 |
| InChI | InChI=1S/C11H10N4S/c1-6-14-9-3-2-7(4-10(9)16-6)8-5-13-15-11(8)12/h2-5H,1H3,(H3,12,13,15) |
| InChIKey | RMVVWUTVZRDUOH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |