C12H12N4OS — CID 79518693
4-(6-ethoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine (PubChem CID 79518693) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-(6-ethoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(6-ethoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 79518693 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-(6-ethoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine |
| SMILES | CCOc1ccc2nc(-c3cn[nH]c3N)sc2c1 |
| InChI | InChI=1S/C12H12N4OS/c1-2-17-7-3-4-9-10(5-7)18-12(15-9)8-6-14-16-11(8)13/h3-6H,2H2,1H3,(H3,13,14,16) |
| InChIKey | BLLPRHIINWCLIC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|