C13H13N5OS — CID 116796248
2-N-(6-ethoxy-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine (PubChem CID 116796248) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-N-(6-ethoxy-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(6-ethoxy-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796248 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-N-(6-ethoxy-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine |
| SMILES | CCOc1ccc2nc(Nc3nccc(N)n3)sc2c1 |
| InChI | InChI=1S/C13H13N5OS/c1-2-19-8-3-4-9-10(7-8)20-13(16-9)18-12-15-6-5-11(14)17-12/h3-7H,2H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | HFGCYSXPTYZHFL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |