C15H12Br2N2OS — CID 78908770
N-(2,4-dibromophenyl)-6-ethoxy-1,3-benzothiazol-2-amine (PubChem CID 78908770) has the molecular formula C15H12Br2N2OS and a molecular weight of 428.15 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-6-ethoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(2,4-dibromophenyl)-6-ethoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 78908770 |
| Molecular Formula | C15H12Br2N2OS |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | N-(2,4-dibromophenyl)-6-ethoxy-1,3-benzothiazol-2-amine |
| SMILES | CCOc1ccc2nc(Nc3ccc(Br)cc3Br)sc2c1 |
| InChI | InChI=1S/C15H12Br2N2OS/c1-2-20-10-4-6-13-14(8-10)21-15(19-13)18-12-5-3-9(16)7-11(12)17/h3-8H,2H2,1H3,(H,18,19) |
| InChIKey | QVVLXJZKWANLSB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |