C10H11BrN2O3S2 — CID 83085276
1-bromo-N-(6-ethoxy-1,3-benzothiazol-2-yl)methanesulfonamide (PubChem CID 83085276) has the molecular formula C10H11BrN2O3S2 and a molecular weight of 351.25 g/mol. Its IUPAC name is 1-bromo-N-(6-ethoxy-1,3-benzothiazol-2-yl)methanesulfonamide.
| Compound Name | 1-bromo-N-(6-ethoxy-1,3-benzothiazol-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 83085276 |
| Molecular Formula | C10H11BrN2O3S2 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 1-bromo-N-(6-ethoxy-1,3-benzothiazol-2-yl)methanesulfonamide |
| SMILES | CCOc1ccc2nc(NS(=O)(=O)CBr)sc2c1 |
| InChI | InChI=1S/C10H11BrN2O3S2/c1-2-16-7-3-4-8-9(5-7)17-10(12-8)13-18(14,15)6-11/h3-5H,2,6H2,1H3,(H,12,13) |
| InChIKey | ZKDCBLCTNPJNKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|