C13H17ClN2O3S2 — CID 116814837
4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)butane-1-sulfonamide (PubChem CID 116814837) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116814837 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)butane-1-sulfonamide |
| SMILES | CCOc1ccc2nc(NS(=O)(=O)CCCCCl)sc2c1 |
| InChI | InChI=1S/C13H17ClN2O3S2/c1-2-19-10-5-6-11-12(9-10)20-13(15-11)16-21(17,18)8-4-3-7-14/h5-6,9H,2-4,7-8H2,1H3,(H,15,16) |
| InChIKey | RCKUNSGYBXPVKM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|